C4H3Cl2N2O+ — CID 144945544
(2,5-dichloropyrimidin-4-yl)oxidanium (PubChem CID 144945544) has the molecular formula C4H3Cl2N2O+ and a molecular weight of 165.99 g/mol. Its IUPAC name is (2,5-dichloropyrimidin-4-yl)oxidanium.
| Compound Name | (2,5-dichloropyrimidin-4-yl)oxidanium |
|---|---|
| PubChem CID | 144945544 |
| Molecular Formula | C4H3Cl2N2O+ |
| Molecular Weight | 165.99 g/mol |
| Exact Mass | 164.96 |
| IUPAC Name | (2,5-dichloropyrimidin-4-yl)oxidanium |
| SMILES | [OH2+]c1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C4H2Cl2N2O/c5-2-1-7-4(6)8-3(2)9/h1H,(H,7,8,9)/p+1 |
| InChIKey | BFXPUIUKFVPUKI-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 48.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.99 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|