C8H10Cl2N2Sn — CID 169089965
tert-butyl-(2,5-dichloropyrimidin-4-yl)tin (PubChem CID 169089965) has the molecular formula C8H10Cl2N2Sn and a molecular weight of 323.80 g/mol. Its IUPAC name is tert-butyl-(2,5-dichloropyrimidin-4-yl)tin.
| Compound Name | tert-butyl-(2,5-dichloropyrimidin-4-yl)tin |
|---|---|
| PubChem CID | 169089965 |
| Molecular Formula | C8H10Cl2N2Sn |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | tert-butyl-(2,5-dichloropyrimidin-4-yl)tin |
| SMILES | CC(C)(C)[Sn]c1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C4HCl2N2.C4H9.Sn/c5-3-1-7-4(6)8-2-3;1-4(2)3;/h1H;1-3H3; |
| InChIKey | GPUZTAGTYACQAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |