C15H17F3O2S — CID 144946056
4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde (PubChem CID 144946056) has the molecular formula C15H17F3O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde.
| Compound Name | 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 144946056 |
| Molecular Formula | C15H17F3O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde |
| SMILES | CCC1(Sc2cccc(C(F)(F)F)c2)CCOC(C=O)C1 |
| InChI | InChI=1S/C15H17F3O2S/c1-2-14(6-7-20-12(9-14)10-19)21-13-5-3-4-11(8-13)15(16,17)18/h3-5,8,10,12H,2,6-7,9H2,1H3 |
| InChIKey | QRTXHLDYSBFLNJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|