C12H13NO3S2 — CID 14494641
(3aR,6aR)-3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazole-2-thione (PubChem CID 14494641) has the molecular formula C12H13NO3S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3aR,6aR)-3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazole-2-thione.
| Compound Name | (3aR,6aR)-3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazole-2-thione |
|---|---|
| PubChem CID | 14494641 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | (3aR,6aR)-3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazole-2-thione |
| SMILES | O=S1(=O)C[C@@H]2OC(=S)N(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C12H13NO3S2/c14-18(15)7-10-11(8-18)16-12(17)13(10)6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | IJQDYSUQTIWLBT-QWRGUYRKSA-N |
| XLogP | 0.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|