C21H26N2O4S2 — CID 20897764
(3R,4S)-3-(benzenesulfonyl)-4-(4-benzylpiperazin-1-yl)thiolane 1,1-dioxide (PubChem CID 20897764) has the molecular formula C21H26N2O4S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is (3R,4S)-3-(benzenesulfonyl)-4-(4-benzylpiperazin-1-yl)thiolane 1,1-dioxide.
| Compound Name | (3R,4S)-3-(benzenesulfonyl)-4-(4-benzylpiperazin-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 20897764 |
| Molecular Formula | C21H26N2O4S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (3R,4S)-3-(benzenesulfonyl)-4-(4-benzylpiperazin-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)C[C@H](N2CCN(Cc3ccccc3)CC2)[C@@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H26N2O4S2/c24-28(25)16-20(21(17-28)29(26,27)19-9-5-2-6-10-19)23-13-11-22(12-14-23)15-18-7-3-1-4-8-18/h1-10,20-21H,11-17H2/t20-,21-/m0/s1 |
| InChIKey | SFXYMDRFADNHID-SFTDATJTSA-N |
| XLogP | 1.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |