C24H31NO4S2 — CID 51834795
(3S,4S)-3-(4-benzylpiperidin-1-yl)-4-(4-ethylphenyl)sulfonylthiolane 1,1-dioxide (PubChem CID 51834795) has the molecular formula C24H31NO4S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is (3S,4S)-3-(4-benzylpiperidin-1-yl)-4-(4-ethylphenyl)sulfonylthiolane 1,1-dioxide.
| Compound Name | (3S,4S)-3-(4-benzylpiperidin-1-yl)-4-(4-ethylphenyl)sulfonylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 51834795 |
| Molecular Formula | C24H31NO4S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (3S,4S)-3-(4-benzylpiperidin-1-yl)-4-(4-ethylphenyl)sulfonylthiolane 1,1-dioxide |
| SMILES | CCc1ccc(S(=O)(=O)[C@@H]2CS(=O)(=O)C[C@@H]2N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H31NO4S2/c1-2-19-8-10-22(11-9-19)31(28,29)24-18-30(26,27)17-23(24)25-14-12-21(13-15-25)16-20-6-4-3-5-7-20/h3-11,21,23-24H,2,12-18H2,1H3/t23-,24+/m0/s1 |
| InChIKey | NSTXCZIEHCQFGE-BJKOFHAPSA-N |
| XLogP | 3.14 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |