C11H15N3O3 — CID 144951822
4-hydroxy-3,5-dimethoxy-N'-methyl-N-(methylideneamino)benzenecarboximidamide (PubChem CID 144951822) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethoxy-N'-methyl-N-(methylideneamino)benzenecarboximidamide.
| Compound Name | 4-hydroxy-3,5-dimethoxy-N'-methyl-N-(methylideneamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 144951822 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-hydroxy-3,5-dimethoxy-N'-methyl-N-(methylideneamino)benzenecarboximidamide |
| SMILES | C=NN/C(=N\C)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H15N3O3/c1-12-11(14-13-2)7-5-8(16-3)10(15)9(6-7)17-4/h5-6,15H,2H2,1,3-4H3,(H,12,14) |
| InChIKey | LPYSRRODLSCREG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|