C8H8B2N2O2 — CID 144955277
CID 144955277 (PubChem CID 144955277) has the molecular formula C8H8B2N2O2 and a molecular weight of 185.79 g/mol.
| Compound Name | CID 144955277 |
|---|---|
| PubChem CID | 144955277 |
| Molecular Formula | C8H8B2N2O2 |
| Molecular Weight | 185.79 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | — |
| SMILES | [B]C([B])(CC(=O)O)Nc1ccccn1 |
| InChI | InChI=1S/C8H8B2N2O2/c9-8(10,5-7(13)14)12-6-3-1-2-4-11-6/h1-4H,5H2,(H,11,12)(H,13,14) |
| InChIKey | XDRDAWXHLRDIFZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.79 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|