C16H17N3O7 — CID 174947436
2-hydroxypropane-1,2,3-tricarboxylic acid;N-pyridin-2-ylpyridin-2-amine (PubChem CID 174947436) has the molecular formula C16H17N3O7 and a molecular weight of 363.33 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;N-pyridin-2-ylpyridin-2-amine.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-pyridin-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 174947436 |
| Molecular Formula | C16H17N3O7 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-pyridin-2-ylpyridin-2-amine |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.c1ccc(Nc2ccccn2)nc1 |
| InChI | InChI=1S/C10H9N3.C6H8O7/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-8H,(H,11,12,13);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RRVDHWKBLOAGIC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |