C20H31FN5O3+ — CID 144957501
[4-[(2S,3S)-3-carboxy-5-methyl-2-(2H-tetrazol-5-yl)hexyl]-2-fluorophenyl]methyl-(3-hydroxybutyl)azanium (PubChem CID 144957501) has the molecular formula C20H31FN5O3+ and a molecular weight of 408.50 g/mol. Its IUPAC name is [4-[(2S,3S)-3-carboxy-5-methyl-2-(2H-tetrazol-5-yl)hexyl]-2-fluorophenyl]methyl-(3-hydroxybutyl)azanium.
| Compound Name | [4-[(2S,3S)-3-carboxy-5-methyl-2-(2H-tetrazol-5-yl)hexyl]-2-fluorophenyl]methyl-(3-hydroxybutyl)azanium |
|---|---|
| PubChem CID | 144957501 |
| Molecular Formula | C20H31FN5O3+ |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [4-[(2S,3S)-3-carboxy-5-methyl-2-(2H-tetrazol-5-yl)hexyl]-2-fluorophenyl]methyl-(3-hydroxybutyl)azanium |
| SMILES | CC(C)C[C@H](C(=O)O)[C@H](Cc1ccc(C[NH2+]CCC(C)O)c(F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C20H30FN5O3/c1-12(2)8-17(20(28)29)16(19-23-25-26-24-19)9-14-4-5-15(18(21)10-14)11-22-7-6-13(3)27/h4-5,10,12-13,16-17,22,27H,6-9,11H2,1-3H3,(H,28,29)(H,23,24,25,26)/p+1/t13?,16-,17-/m0/s1 |
| InChIKey | XMIYFHPJXSFALP-LMARGRMVSA-O |
| XLogP | 1.25 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|