C31H40N8O8S2 — CID 129273544
(2S)-5-[(2S)-4-methyl-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoyl]oxy-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 129273544) has the molecular formula C31H40N8O8S2 and a molecular weight of 716.84 g/mol. Its IUPAC name is (2S)-5-[(2S)-4-methyl-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoyl]oxy-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | (2S)-5-[(2S)-4-methyl-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoyl]oxy-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 129273544 |
| Molecular Formula | C31H40N8O8S2 |
| Molecular Weight | 716.84 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | (2S)-5-[(2S)-4-methyl-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoyl]oxy-2-[(1S)-2-(4-methylsulfonylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CC(C)C[C@H](C(=O)OCCC[C@H](C(=O)O)[C@H](Cc1ccc(S(C)(=O)=O)cc1)c1nn[nH]n1)[C@H](Cc1ccc(S(C)(=O)=O)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C31H40N8O8S2/c1-19(2)16-27(26(29-34-38-39-35-29)18-21-9-13-23(14-10-21)49(4,45)46)31(42)47-15-5-6-24(30(40)41)25(28-32-36-37-33-28)17-20-7-11-22(12-8-20)48(3,43)44/h7-14,19,24-27H,5-6,15-18H2,1-4H3,(H,40,41)(H,32,33,36,37)(H,34,35,38,39)/t24-,25-,26-,27-/m0/s1 |
| InChIKey | APHXHFGGZXUINS-FWEHEUNISA-N |
| XLogP | 2.56 |
| TPSA | 240.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|