C28H35FN2O3 — CID 144958145
ethyl 2-[2-(4-fluorophenyl)ethyl-[(9R)-6-methoxy-9,12-dimethyl-12-azatetracyclo[7.4.1.01,11.03,8]tetradeca-3(8),4,6-trien-10-yl]amino]acetate (PubChem CID 144958145) has the molecular formula C28H35FN2O3 and a molecular weight of 466.60 g/mol. Its IUPAC name is ethyl 2-[2-(4-fluorophenyl)ethyl-[(9R)-6-methoxy-9,12-dimethyl-12-azatetracyclo[7.4.1.01,11.03,8]tetradeca-3(8),4,6-trien-10-yl]amino]acetate.
| Compound Name | ethyl 2-[2-(4-fluorophenyl)ethyl-[(9R)-6-methoxy-9,12-dimethyl-12-azatetracyclo[7.4.1.01,11.03,8]tetradeca-3(8),4,6-trien-10-yl]amino]acetate |
|---|---|
| PubChem CID | 144958145 |
| Molecular Formula | C28H35FN2O3 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | ethyl 2-[2-(4-fluorophenyl)ethyl-[(9R)-6-methoxy-9,12-dimethyl-12-azatetracyclo[7.4.1.01,11.03,8]tetradeca-3(8),4,6-trien-10-yl]amino]acetate |
| SMILES | CCOC(=O)CN(CCc1ccc(F)cc1)C1C2N(C)CC23Cc2ccc(OC)cc2[C@@]1(C)C3 |
| InChI | InChI=1S/C28H35FN2O3/c1-5-34-24(32)16-31(13-12-19-6-9-21(29)10-7-19)25-26-28(18-30(26)3)15-20-8-11-22(33-4)14-23(20)27(25,2)17-28/h6-11,14,25-26H,5,12-13,15-18H2,1-4H3/t25?,26?,27-,28?/m1/s1 |
| InChIKey | SSRWLJZBQZQLAP-BFVYBWTQSA-N |
| XLogP | 3.83 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |