C11H10N2O — CID 144961435
N-[3-[(Z)-prop-1-enyl]furo[2,3-b]pyridin-2-yl]methanimine (PubChem CID 144961435) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is N-[3-[(Z)-prop-1-enyl]furo[2,3-b]pyridin-2-yl]methanimine.
| Compound Name | N-[3-[(Z)-prop-1-enyl]furo[2,3-b]pyridin-2-yl]methanimine |
|---|---|
| PubChem CID | 144961435 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | N-[3-[(Z)-prop-1-enyl]furo[2,3-b]pyridin-2-yl]methanimine |
| SMILES | C=Nc1oc2ncccc2c1/C=C\C |
| InChI | InChI=1S/C11H10N2O/c1-3-5-8-9-6-4-7-13-11(9)14-10(8)12-2/h3-7H,2H2,1H3/b5-3- |
| InChIKey | SNOQMKAOSZSAQX-HYXAFXHYSA-N |
| XLogP | 3.19 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|