C22H21F3N4OS — CID 144961568
1-[(4-pyrimidin-5-ylphenyl)methyl]-N-[3-(trifluoromethoxy)phenyl]sulfanylpyrrolidin-3-amine (PubChem CID 144961568) has the molecular formula C22H21F3N4OS and a molecular weight of 446.50 g/mol. Its IUPAC name is 1-[(4-pyrimidin-5-ylphenyl)methyl]-N-[3-(trifluoromethoxy)phenyl]sulfanylpyrrolidin-3-amine.
| Compound Name | 1-[(4-pyrimidin-5-ylphenyl)methyl]-N-[3-(trifluoromethoxy)phenyl]sulfanylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 144961568 |
| Molecular Formula | C22H21F3N4OS |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-[(4-pyrimidin-5-ylphenyl)methyl]-N-[3-(trifluoromethoxy)phenyl]sulfanylpyrrolidin-3-amine |
| SMILES | FC(F)(F)Oc1cccc(SNC2CCN(Cc3ccc(-c4cncnc4)cc3)C2)c1 |
| InChI | InChI=1S/C22H21F3N4OS/c23-22(24,25)30-20-2-1-3-21(10-20)31-28-19-8-9-29(14-19)13-16-4-6-17(7-5-16)18-11-26-15-27-12-18/h1-7,10-12,15,19,28H,8-9,13-14H2 |
| InChIKey | RWLZZJMPDPYUJK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|