C20H24N4OS — CID 144961661
5-[[1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]amino]sulfanylpyridine-2-carbonitrile (PubChem CID 144961661) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 5-[[1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]amino]sulfanylpyridine-2-carbonitrile.
| Compound Name | 5-[[1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]amino]sulfanylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 144961661 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 5-[[1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]amino]sulfanylpyridine-2-carbonitrile |
| SMILES | CC(C)Oc1ccc(CN2CCC(NSc3ccc(C#N)nc3)C2)cc1 |
| InChI | InChI=1S/C20H24N4OS/c1-15(2)25-19-6-3-16(4-7-19)13-24-10-9-18(14-24)23-26-20-8-5-17(11-21)22-12-20/h3-8,12,15,18,23H,9-10,13-14H2,1-2H3 |
| InChIKey | WMUREUZSLHRKOB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|