C22H30N2O2S2 — CID 144961700
(3R)-N-(2-methyl-5-methylsulfinylphenyl)sulfanyl-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-amine (PubChem CID 144961700) has the molecular formula C22H30N2O2S2 and a molecular weight of 418.63 g/mol. Its IUPAC name is (3R)-N-(2-methyl-5-methylsulfinylphenyl)sulfanyl-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | (3R)-N-(2-methyl-5-methylsulfinylphenyl)sulfanyl-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 144961700 |
| Molecular Formula | C22H30N2O2S2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (3R)-N-(2-methyl-5-methylsulfinylphenyl)sulfanyl-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-amine |
| SMILES | Cc1ccc(S(C)=O)cc1SN[C@@H]1CCN(Cc2ccc(OC(C)C)cc2)C1 |
| InChI | InChI=1S/C22H30N2O2S2/c1-16(2)26-20-8-6-18(7-9-20)14-24-12-11-19(15-24)23-27-22-13-21(28(4)25)10-5-17(22)3/h5-10,13,16,19,23H,11-12,14-15H2,1-4H3/t19-,28?/m1/s1 |
| InChIKey | HHRSTYGWOYMCEN-OJQMSQGESA-N |
| XLogP | 4.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|