C13H26N2O — CID 144962852
(3aS,6aR)-5-[(3-methyloxetan-3-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane (PubChem CID 144962852) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (3aS,6aR)-5-[(3-methyloxetan-3-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane.
| Compound Name | (3aS,6aR)-5-[(3-methyloxetan-3-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane |
|---|---|
| PubChem CID | 144962852 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (3aS,6aR)-5-[(3-methyloxetan-3-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane |
| SMILES | CC.CC1(CN2C[C@H]3CNC[C@H]3C2)COC1 |
| InChI | InChI=1S/C11H20N2O.C2H6/c1-11(7-14-8-11)6-13-4-9-2-12-3-10(9)5-13;1-2/h9-10,12H,2-8H2,1H3;1-2H3/t9-,10+; |
| InChIKey | JXTRDFJLBVRFOR-JMVWIVNTSA-N |
| XLogP | 1.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |