About 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine
1-methyl-3-(4-methylphenyl)benzene;propan-1-imine (PubChem CID 144963776) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine.
Molecular Properties
| Compound Name | 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine |
| PubChem CID | 144963776 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine |
| SMILES | Cc1ccc(-c2cccc(C)c2)cc1.[H]/N=C/CC |
| InChI | InChI=1S/C14H14.C3H7N/c1-11-6-8-13(9-7-11)14-5-3-4-12(2)10-14;1-2-3-4/h3-10H,1-2H3;3-4H,2H2,1H3/b;4-3+ |
| InChIKey | BNSXJZCLTXYHSL-SCBDLNNBSA-N |
| XLogP | 5.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine?
The IUPAC name of 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine (CID 144963776) is 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine.
What is the SMILES notation for 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine?
The canonical SMILES for 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine is Cc1ccc(-c2cccc(C)c2)cc1.[H]/N=C/CC.
What is the InChIKey of 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine?
The InChIKey is BNSXJZCLTXYHSL-SCBDLNNBSA-N. The full InChI is InChI=1S/C14H14.C3H7N/c1-11-6-8-13(9-7-11)14-5-3-4-12(2)10-14;1-2-3-4/h3-10H,1-2H3;3-4H,2H2,1H3/b;4-3+.
What are the key properties of 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine?
1-methyl-3-(4-methylphenyl)benzene;propan-1-imine has a molecular weight of 239.36 g/mol, XLogP of 5.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(4-methylphenyl)benzene;propan-1-imine is sourced from PubChem (CID 144963776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).