C7H10ClIO3 — CID 144970267
iodo (E,3S)-7-chloro-3-hydroxyhept-4-enoate (PubChem CID 144970267) has the molecular formula C7H10ClIO3 and a molecular weight of 304.51 g/mol. Its IUPAC name is iodo (E,3S)-7-chloro-3-hydroxyhept-4-enoate.
| Compound Name | iodo (E,3S)-7-chloro-3-hydroxyhept-4-enoate |
|---|---|
| PubChem CID | 144970267 |
| Molecular Formula | C7H10ClIO3 |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | iodo (E,3S)-7-chloro-3-hydroxyhept-4-enoate |
| SMILES | O=C(C[C@H](O)/C=C/CCCl)OI |
| InChI | InChI=1S/C7H10ClIO3/c8-4-2-1-3-6(10)5-7(11)12-9/h1,3,6,10H,2,4-5H2/b3-1+/t6-/m1/s1 |
| InChIKey | WCOHYDNSSHDDQK-OFRQFNDLSA-N |
| XLogP | 1.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|