C29H33F2N7O3S — CID 144973025
4-[2-amino-4-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenoxy]piperidine-1-sulfinic acid (PubChem CID 144973025) has the molecular formula C29H33F2N7O3S and a molecular weight of 597.69 g/mol. Its IUPAC name is 4-[2-amino-4-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenoxy]piperidine-1-sulfinic acid.
| Compound Name | 4-[2-amino-4-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenoxy]piperidine-1-sulfinic acid |
|---|---|
| PubChem CID | 144973025 |
| Molecular Formula | C29H33F2N7O3S |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | 4-[2-amino-4-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenoxy]piperidine-1-sulfinic acid |
| SMILES | Nc1cc(-c2ncnc3[nH]c(-c4ccc(N5CCN(CC(F)F)CC5)cc4)cc23)ccc1OC1CCN(S(=O)O)CC1 |
| InChI | InChI=1S/C29H33F2N7O3S/c30-27(31)17-36-11-13-37(14-12-36)21-4-1-19(2-5-21)25-16-23-28(33-18-34-29(23)35-25)20-3-6-26(24(32)15-20)41-22-7-9-38(10-8-22)42(39)40/h1-6,15-16,18,22,27H,7-14,17,32H2,(H,39,40)(H,33,34,35) |
| InChIKey | ZWYHFHMSJHKOSV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|