C11H17NO4 — CID 144977448
ethane;methyl (2E,3E)-2-ethylidene-3-nitrohexa-3,5-dienoate (PubChem CID 144977448) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is ethane;methyl (2E,3E)-2-ethylidene-3-nitrohexa-3,5-dienoate.
| Compound Name | ethane;methyl (2E,3E)-2-ethylidene-3-nitrohexa-3,5-dienoate |
|---|---|
| PubChem CID | 144977448 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethane;methyl (2E,3E)-2-ethylidene-3-nitrohexa-3,5-dienoate |
| SMILES | C=C/C=C(C(=C/C)\C(=O)OC)/[N+](=O)[O-].CC |
| InChI | InChI=1S/C9H11NO4.C2H6/c1-4-6-8(10(12)13)7(5-2)9(11)14-3;1-2/h4-6H,1H2,2-3H3;1-2H3/b7-5+,8-6+; |
| InChIKey | UBTJMZUGNPFEPV-PUFOULASSA-N |
| XLogP | 2.48 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|