C19H25N3OS — CID 144978595
(5S,10S)-13-hydroxy-N,3-dimethyl-3,7-diazapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-triene-7-carbothioamide (PubChem CID 144978595) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is (5S,10S)-13-hydroxy-N,3-dimethyl-3,7-diazapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-triene-7-carbothioamide.
| Compound Name | (5S,10S)-13-hydroxy-N,3-dimethyl-3,7-diazapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-triene-7-carbothioamide |
|---|---|
| PubChem CID | 144978595 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (5S,10S)-13-hydroxy-N,3-dimethyl-3,7-diazapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-triene-7-carbothioamide |
| SMILES | CNC(=S)N1CC[C@]23CC4(Cc5ccc(O)cc52)CN(C)C4[C@@H]3C1 |
| InChI | InChI=1S/C19H25N3OS/c1-20-17(24)22-6-5-19-10-18(11-21(2)16(18)15(19)9-22)8-12-3-4-13(23)7-14(12)19/h3-4,7,15-16,23H,5-6,8-11H2,1-2H3,(H,20,24)/t15-,16?,18?,19-/m0/s1 |
| InChIKey | ITBKHRVKRTWXGZ-GSHBMFQSSA-N |
| XLogP | 1.72 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|