C37H30N2 — CID 144979749
5-imino-N-methyl-1-phenyl-5-(9,9'-spirobi[fluorene]-2-yl)pent-1-en-1-amine (PubChem CID 144979749) has the molecular formula C37H30N2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 5-imino-N-methyl-1-phenyl-5-(9,9'-spirobi[fluorene]-2-yl)pent-1-en-1-amine.
| Compound Name | 5-imino-N-methyl-1-phenyl-5-(9,9'-spirobi[fluorene]-2-yl)pent-1-en-1-amine |
|---|---|
| PubChem CID | 144979749 |
| Molecular Formula | C37H30N2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 5-imino-N-methyl-1-phenyl-5-(9,9'-spirobi[fluorene]-2-yl)pent-1-en-1-amine |
| SMILES | [H]/N=C(\CCC=C(NC)c1ccccc1)c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C37H30N2/c1-39-36(25-12-3-2-4-13-25)21-11-20-35(38)26-22-23-30-29-16-7-10-19-33(29)37(34(30)24-26)31-17-8-5-14-27(31)28-15-6-9-18-32(28)37/h2-10,12-19,21-24,38-39H,11,20H2,1H3/b36-21?,38-35+ |
| InChIKey | FMYLGZWAGTVZLX-IRKRCXGJSA-N |
| XLogP | 8.44 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|