C11H17FO2S — CID 144983800
(2E,4E,6Z)-1-ethylsulfonyl-4-fluoro-3-methylocta-2,4,6-triene (PubChem CID 144983800) has the molecular formula C11H17FO2S and a molecular weight of 232.32 g/mol. Its IUPAC name is (2E,4E,6Z)-1-ethylsulfonyl-4-fluoro-3-methylocta-2,4,6-triene.
| Compound Name | (2E,4E,6Z)-1-ethylsulfonyl-4-fluoro-3-methylocta-2,4,6-triene |
|---|---|
| PubChem CID | 144983800 |
| Molecular Formula | C11H17FO2S |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2E,4E,6Z)-1-ethylsulfonyl-4-fluoro-3-methylocta-2,4,6-triene |
| SMILES | C/C=C\C=C(F)/C(C)=C/CS(=O)(=O)CC |
| InChI | InChI=1S/C11H17FO2S/c1-4-6-7-11(12)10(3)8-9-15(13,14)5-2/h4,6-8H,5,9H2,1-3H3/b6-4-,10-8+,11-7+ |
| InChIKey | UXCWHISUHGMJLI-DCINQGNBSA-N |
| XLogP | 2.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|