About 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide
1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide (PubChem CID 144985194) has the molecular formula C20H21ClN2O3
and a molecular weight of 372.85 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide.
Molecular Properties
| Compound Name | 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide |
| PubChem CID | 144985194 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide |
| SMILES | COc1ccc2c(c1)c(CNC=O)c(C)n2C=O.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14N2O3.C7H7Cl/c1-9-12(6-14-7-16)11-5-10(18-2)3-4-13(11)15(9)8-17;1-6-2-4-7(8)5-3-6/h3-5,7-8H,6H2,1-2H3,(H,14,16);2-5H,1H3 |
| InChIKey | MVIKXRDYXSXNAO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide?
The IUPAC name of 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide (CID 144985194) is 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide.
What is the SMILES notation for 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide?
The canonical SMILES for 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide is COc1ccc2c(c1)c(CNC=O)c(C)n2C=O.Cc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide?
The InChIKey is MVIKXRDYXSXNAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3.C7H7Cl/c1-9-12(6-14-7-16)11-5-10(18-2)3-4-13(11)15(9)8-17;1-6-2-4-7(8)5-3-6/h3-5,7-8H,6H2,1-2H3,(H,14,16);2-5H,1H3.
What are the key properties of 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide?
1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide has a molecular weight of 372.85 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene;N-[(1-formyl-5-methoxy-2-methylindol-3-yl)methyl]formamide is sourced from PubChem (CID 144985194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).