About 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane
1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane (PubChem CID 144985716) has the molecular formula C15H23F2NO2
and a molecular weight of 287.35 g/mol. Its IUPAC name is 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane.
Molecular Properties
| Compound Name | 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane |
| PubChem CID | 144985716 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane |
| SMILES | C1CCOC1.COc1ccc(F)cc1.FC1CCNC1 |
| InChI | InChI=1S/C7H7FO.C4H8FN.C4H8O/c1-9-7-4-2-6(8)3-5-7;5-4-1-2-6-3-4;1-2-4-5-3-1/h2-5H,1H3;4,6H,1-3H2;1-4H2 |
| InChIKey | NPVBZLBZZRDJPT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane?
The IUPAC name of 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane (CID 144985716) is 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane.
What is the SMILES notation for 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane?
The canonical SMILES for 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane is C1CCOC1.COc1ccc(F)cc1.FC1CCNC1.
What is the InChIKey of 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane?
The InChIKey is NPVBZLBZZRDJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.C4H8FN.C4H8O/c1-9-7-4-2-6(8)3-5-7;5-4-1-2-6-3-4;1-2-4-5-3-1/h2-5H,1H3;4,6H,1-3H2;1-4H2.
What are the key properties of 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane?
1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane has a molecular weight of 287.35 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methoxybenzene;3-fluoropyrrolidine;oxolane is sourced from PubChem (CID 144985716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).