C17H21N3O3 — CID 144986647
6-methyl-4-oxo-N-pyridin-2-yl-1H-pyridine-2-carboxamide;oxane (PubChem CID 144986647) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-pyridin-2-yl-1H-pyridine-2-carboxamide;oxane.
| Compound Name | 6-methyl-4-oxo-N-pyridin-2-yl-1H-pyridine-2-carboxamide;oxane |
|---|---|
| PubChem CID | 144986647 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 6-methyl-4-oxo-N-pyridin-2-yl-1H-pyridine-2-carboxamide;oxane |
| SMILES | C1CCOCC1.Cc1cc(=O)cc(C(=O)Nc2ccccn2)[nH]1 |
| InChI | InChI=1S/C12H11N3O2.C5H10O/c1-8-6-9(16)7-10(14-8)12(17)15-11-4-2-3-5-13-11;1-2-4-6-5-3-1/h2-7H,1H3,(H,14,16)(H,13,15,17);1-5H2 |
| InChIKey | WLOIOUIFPLAZHI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |