C16H17F3O6S — CID 144987933
[(3Z,6E,7E)-9-formyl-7-methoxy-6-(methoxymethylidene)-5-methylidenedeca-1,3,7,9-tetraen-2-yl] trifluoromethanesulfonate (PubChem CID 144987933) has the molecular formula C16H17F3O6S and a molecular weight of 394.37 g/mol. Its IUPAC name is [(3Z,6E,7E)-9-formyl-7-methoxy-6-(methoxymethylidene)-5-methylidenedeca-1,3,7,9-tetraen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(3Z,6E,7E)-9-formyl-7-methoxy-6-(methoxymethylidene)-5-methylidenedeca-1,3,7,9-tetraen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 144987933 |
| Molecular Formula | C16H17F3O6S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [(3Z,6E,7E)-9-formyl-7-methoxy-6-(methoxymethylidene)-5-methylidenedeca-1,3,7,9-tetraen-2-yl] trifluoromethanesulfonate |
| SMILES | C=C(C=O)/C=C(OC)\C(=C\OC)C(=C)/C=C\C(=C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3O6S/c1-11(9-20)8-15(24-5)14(10-23-4)12(2)6-7-13(3)25-26(21,22)16(17,18)19/h6-10H,1-3H2,4-5H3/b7-6-,14-10+,15-8+ |
| InChIKey | ZANHQFVTSLUHOW-FAUDRWSXSA-N |
| XLogP | 3.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|