C14H13F3O5S — CID 166974086
[2-formyl-4-[(2E)-4-methoxypenta-2,4-dien-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 166974086) has the molecular formula C14H13F3O5S and a molecular weight of 350.31 g/mol. Its IUPAC name is [2-formyl-4-[(2E)-4-methoxypenta-2,4-dien-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-formyl-4-[(2E)-4-methoxypenta-2,4-dien-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166974086 |
| Molecular Formula | C14H13F3O5S |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | [2-formyl-4-[(2E)-4-methoxypenta-2,4-dien-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | C=C(/C=C(\C)c1ccc(OS(=O)(=O)C(F)(F)F)c(C=O)c1)OC |
| InChI | InChI=1S/C14H13F3O5S/c1-9(6-10(2)21-3)11-4-5-13(12(7-11)8-18)22-23(19,20)14(15,16)17/h4-8H,2H2,1,3H3/b9-6+ |
| InChIKey | BYMLCKWMLLMHDT-RMKNXTFCSA-N |
| XLogP | 3.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|