C18H21ClN4S — CID 144988226
6-chloro-N-(1,5-dimethylpyrazol-3-yl)-4-phenylsulfanylpyridin-2-amine;ethane (PubChem CID 144988226) has the molecular formula C18H21ClN4S and a molecular weight of 360.91 g/mol. Its IUPAC name is 6-chloro-N-(1,5-dimethylpyrazol-3-yl)-4-phenylsulfanylpyridin-2-amine;ethane.
| Compound Name | 6-chloro-N-(1,5-dimethylpyrazol-3-yl)-4-phenylsulfanylpyridin-2-amine;ethane |
|---|---|
| PubChem CID | 144988226 |
| Molecular Formula | C18H21ClN4S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 6-chloro-N-(1,5-dimethylpyrazol-3-yl)-4-phenylsulfanylpyridin-2-amine;ethane |
| SMILES | CC.Cc1cc(Nc2cc(Sc3ccccc3)cc(Cl)n2)nn1C |
| InChI | InChI=1S/C16H15ClN4S.C2H6/c1-11-8-16(20-21(11)2)19-15-10-13(9-14(17)18-15)22-12-6-4-3-5-7-12;1-2/h3-10H,1-2H3,(H,18,19,20);1-2H3 |
| InChIKey | JZXBHLSYGHVUCI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|