C30H49BO7S — CID 144990808
tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate;1-methoxybutane (PubChem CID 144990808) has the molecular formula C30H49BO7S and a molecular weight of 564.59 g/mol. Its IUPAC name is tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate;1-methoxybutane.
| Compound Name | tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate;1-methoxybutane |
|---|---|
| PubChem CID | 144990808 |
| Molecular Formula | C30H49BO7S |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate;1-methoxybutane |
| SMILES | CCCCOC.CSc1ccc(CB2OC(C)C(C)(C3CC(C)C3(C)C)O2)c(OC(=O)OC(C)(C)C)c1C=O |
| InChI | InChI=1S/C25H37BO6S.C5H12O/c1-15-12-20(24(15,6)7)25(8)16(2)31-26(32-25)13-17-10-11-19(33-9)18(14-27)21(17)29-22(28)30-23(3,4)5;1-3-4-5-6-2/h10-11,14-16,20H,12-13H2,1-9H3;3-5H2,1-2H3 |
| InChIKey | DGWJADMGOJJRTD-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|