C25H37BO6S — CID 144990809
tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate (PubChem CID 144990809) has the molecular formula C25H37BO6S and a molecular weight of 476.44 g/mol. Its IUPAC name is tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate.
| Compound Name | tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate |
|---|---|
| PubChem CID | 144990809 |
| Molecular Formula | C25H37BO6S |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | tert-butyl [6-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-formyl-3-methylsulfanylphenyl] carbonate |
| SMILES | CSc1ccc(CB2OC(C)C(C)(C3CC(C)C3(C)C)O2)c(OC(=O)OC(C)(C)C)c1C=O |
| InChI | InChI=1S/C25H37BO6S/c1-15-12-20(24(15,6)7)25(8)16(2)31-26(32-25)13-17-10-11-19(33-9)18(14-27)21(17)29-22(28)30-23(3,4)5/h10-11,14-16,20H,12-13H2,1-9H3 |
| InChIKey | BHBDQZPQTZUBDQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|