C35H55BO9S — CID 156746528
tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate (PubChem CID 156746528) has the molecular formula C35H55BO9S and a molecular weight of 662.69 g/mol. Its IUPAC name is tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate.
| Compound Name | tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate |
|---|---|
| PubChem CID | 156746528 |
| Molecular Formula | C35H55BO9S |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate |
| SMILES | CCOC(CSc1ccc(C[C@@H](C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)c(OC(=O)OC(C)(C)C)c1C(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C35H55BO9S/c1-13-39-27(40-14-2)20-46-24-16-15-22(29(41-31(38)43-33(7,8)9)28(24)30(37)42-32(4,5)6)17-21(3)36-44-26-19-23-18-25(34(23,10)11)35(26,12)45-36/h15-16,21,23,25-27H,13-14,17-20H2,1-12H3/t21-,23+,25+,26-,35+/m1/s1 |
| InChIKey | ZHPRSIALFRPDRG-CEPKBVHWSA-N |
| XLogP | 8.11 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|