C31H49BO7S — CID 144663818
butyl 3-[2-[5-ethyl-4-methyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate (PubChem CID 144663818) has the molecular formula C31H49BO7S and a molecular weight of 576.61 g/mol. Its IUPAC name is butyl 3-[2-[5-ethyl-4-methyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate.
| Compound Name | butyl 3-[2-[5-ethyl-4-methyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 144663818 |
| Molecular Formula | C31H49BO7S |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | butyl 3-[2-[5-ethyl-4-methyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate |
| SMILES | CCCCOC(=O)c1c(SC)ccc(CCB2OC(CC)C(C)(C3CC(C)C3(C)C)O2)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H49BO7S/c1-11-13-18-35-27(33)25-22(40-10)15-14-21(26(25)36-28(34)37-29(4,5)6)16-17-32-38-24(12-2)31(9,39-32)23-19-20(3)30(23,7)8/h14-15,20,23-24H,11-13,16-19H2,1-10H3 |
| InChIKey | JSKQATIXYQDOBL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|