C35H47BO8S — CID 156746399
tert-butyl 6-[(4-methoxyphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate (PubChem CID 156746399) has the molecular formula C35H47BO8S and a molecular weight of 638.63 g/mol. Its IUPAC name is tert-butyl 6-[(4-methoxyphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate.
| Compound Name | tert-butyl 6-[(4-methoxyphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 156746399 |
| Molecular Formula | C35H47BO8S |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | tert-butyl 6-[(4-methoxyphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
| SMILES | COc1ccc(CSc2ccc(CB3O[C@@H]4C[C@@H]5C[C@@H](C5(C)C)[C@]4(C)O3)c(OC(=O)OC(C)(C)C)c2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H47BO8S/c1-32(2,3)41-30(37)28-25(45-20-21-11-14-24(39-10)15-12-21)16-13-22(29(28)40-31(38)42-33(4,5)6)19-36-43-27-18-23-17-26(34(23,7)8)35(27,9)44-36/h11-16,23,26-27H,17-20H2,1-10H3/t23-,26-,27+,35-/m0/s1 |
| InChIKey | LGKMJSZRFWAMGA-RKSWQEIFSA-N |
| XLogP | 8.07 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|