C33H50BN3O8S2 — CID 144990774
[6-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1,4,5-trimethyl-9,11-dioxa-10-boratricyclo[6.3.0.02,5]undecan-10-yl)ethyl]-2-formyl-3-methoxyphenyl] tert-butyl carbonate;1-methoxybutane (PubChem CID 144990774) has the molecular formula C33H50BN3O8S2 and a molecular weight of 691.72 g/mol. Its IUPAC name is [6-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1,4,5-trimethyl-9,11-dioxa-10-boratricyclo[6.3.0.02,5]undecan-10-yl)ethyl]-2-formyl-3-methoxyphenyl] tert-butyl carbonate;1-methoxybutane.
| Compound Name | [6-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1,4,5-trimethyl-9,11-dioxa-10-boratricyclo[6.3.0.02,5]undecan-10-yl)ethyl]-2-formyl-3-methoxyphenyl] tert-butyl carbonate;1-methoxybutane |
|---|---|
| PubChem CID | 144990774 |
| Molecular Formula | C33H50BN3O8S2 |
| Molecular Weight | 691.72 g/mol |
| Exact Mass | 691.31 |
| IUPAC Name | [6-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1,4,5-trimethyl-9,11-dioxa-10-boratricyclo[6.3.0.02,5]undecan-10-yl)ethyl]-2-formyl-3-methoxyphenyl] tert-butyl carbonate;1-methoxybutane |
| SMILES | CCCCOC.COc1ccc(CC(Sc2nnc(N)s2)B2OC3CCC4(C)C(C)CC4C3(C)O2)c(OC(=O)OC(C)(C)C)c1C=O |
| InChI | InChI=1S/C28H38BN3O7S2.C5H12O/c1-15-12-19-27(15,5)11-10-20-28(19,6)39-29(38-20)21(40-24-32-31-23(30)41-24)13-16-8-9-18(35-7)17(14-33)22(16)36-25(34)37-26(2,3)4;1-3-4-5-6-2/h8-9,14-15,19-21H,10-13H2,1-7H3,(H2,30,31);3-5H2,1-2H3 |
| InChIKey | LNLVOSAKHPWCGT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 141.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|