C26H33BN4O6S2 — CID 90277162
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide (PubChem CID 90277162) has the molecular formula C26H33BN4O6S2 and a molecular weight of 572.52 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 90277162 |
| Molecular Formula | C26H33BN4O6S2 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide |
| SMILES | CC1(C)OC(=O)c2cccc(C[C@H](NC(=O)CSc3nnc(N)s3)B3OC4C[C@@H]5C[C@@H](C5(C)C)[C@]4(C)O3)c2O1 |
| InChI | InChI=1S/C26H33BN4O6S2/c1-24(2)14-10-16(24)26(5)17(11-14)36-27(37-26)18(29-19(32)12-38-23-31-30-22(28)39-23)9-13-7-6-8-15-20(13)34-25(3,4)35-21(15)33/h6-8,14,16-18H,9-12H2,1-5H3,(H2,28,30)(H,29,32)/t14-,16-,17?,18-,26-/m0/s1 |
| InChIKey | IHUULFAXVTWFGU-CBAYCOSVSA-N |
| XLogP | 3.49 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|