C26H32N4O3S2 — CID 144991551
4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidine-5-carbaldehyde;2-(5-methylthiophen-3-yl)-2-phenyloxolane (PubChem CID 144991551) has the molecular formula C26H32N4O3S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidine-5-carbaldehyde;2-(5-methylthiophen-3-yl)-2-phenyloxolane.
| Compound Name | 4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidine-5-carbaldehyde;2-(5-methylthiophen-3-yl)-2-phenyloxolane |
|---|---|
| PubChem CID | 144991551 |
| Molecular Formula | C26H32N4O3S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidine-5-carbaldehyde;2-(5-methylthiophen-3-yl)-2-phenyloxolane |
| SMILES | Cc1cc(C2(c3ccccc3)CCCO2)cs1.NSOCC1CCC(Nc2ncncc2C=O)C1 |
| InChI | InChI=1S/C15H16OS.C11H16N4O2S/c1-12-10-14(11-17-12)15(8-5-9-16-15)13-6-3-2-4-7-13;12-18-17-6-8-1-2-10(3-8)15-11-9(5-16)4-13-7-14-11/h2-4,6-7,10-11H,5,8-9H2,1H3;4-5,7-8,10H,1-3,6,12H2,(H,13,14,15) |
| InChIKey | IVWPYYSJPLJRIM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|