C19H28N2O2S — CID 144991813
2-amino-N-[(Z)-2-ethoxybut-2-enyl]-N-(thiophen-2-ylmethyl)acetamide;benzene;molecular hydrogen (PubChem CID 144991813) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-amino-N-[(Z)-2-ethoxybut-2-enyl]-N-(thiophen-2-ylmethyl)acetamide;benzene;molecular hydrogen.
| Compound Name | 2-amino-N-[(Z)-2-ethoxybut-2-enyl]-N-(thiophen-2-ylmethyl)acetamide;benzene;molecular hydrogen |
|---|---|
| PubChem CID | 144991813 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-amino-N-[(Z)-2-ethoxybut-2-enyl]-N-(thiophen-2-ylmethyl)acetamide;benzene;molecular hydrogen |
| SMILES | C/C=C(/CN(Cc1cccs1)C(=O)CN)OCC.[H][H].c1ccccc1 |
| InChI | InChI=1S/C13H20N2O2S.C6H6.H2/c1-3-11(17-4-2)9-15(13(16)8-14)10-12-6-5-7-18-12;1-2-4-6-5-3-1;/h3,5-7H,4,8-10,14H2,1-2H3;1-6H;1H/b11-3-;; |
| InChIKey | SSHCIYCKGPSXMS-APRVNQMFSA-N |
| XLogP | 3.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|