C25H26N6O4 — CID 144991884
3-[[amino-[2-amino-4-[4-(phenylcarbamoyl)phenoxy]-3-pyridinyl]methylidene]amino]piperidine-1-carboxylic acid (PubChem CID 144991884) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[[amino-[2-amino-4-[4-(phenylcarbamoyl)phenoxy]-3-pyridinyl]methylidene]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[amino-[2-amino-4-[4-(phenylcarbamoyl)phenoxy]-3-pyridinyl]methylidene]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 144991884 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 3-[[amino-[2-amino-4-[4-(phenylcarbamoyl)phenoxy]-3-pyridinyl]methylidene]amino]piperidine-1-carboxylic acid |
| SMILES | N/C(=N\C1CCCN(C(=O)O)C1)c1c(Oc2ccc(C(=O)Nc3ccccc3)cc2)ccnc1N |
| InChI | InChI=1S/C25H26N6O4/c26-22-21(23(27)29-18-7-4-14-31(15-18)25(33)34)20(12-13-28-22)35-19-10-8-16(9-11-19)24(32)30-17-5-2-1-3-6-17/h1-3,5-6,8-13,18H,4,7,14-15H2,(H2,26,28)(H2,27,29)(H,30,32)(H,33,34) |
| InChIKey | MEJHADRSKFMCOM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 156.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|