C20H23F4N7O2 — CID 144992740
N-[(1E,3Z)-1,4-diamino-7-fluoro-8-(4-formyltriazol-1-yl)octa-1,3-dienyl]-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetamide (PubChem CID 144992740) has the molecular formula C20H23F4N7O2 and a molecular weight of 469.44 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-7-fluoro-8-(4-formyltriazol-1-yl)octa-1,3-dienyl]-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-7-fluoro-8-(4-formyltriazol-1-yl)octa-1,3-dienyl]-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 144992740 |
| Molecular Formula | C20H23F4N7O2 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-7-fluoro-8-(4-formyltriazol-1-yl)octa-1,3-dienyl]-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetamide |
| SMILES | Cc1cc(C(F)(F)F)cc(CC(=O)N/C(N)=C/C=C(\N)CCC(F)Cn2cc(C=O)nn2)n1 |
| InChI | InChI=1S/C20H23F4N7O2/c1-12-6-13(20(22,23)24)7-16(27-12)8-19(33)28-18(26)5-4-15(25)3-2-14(21)9-31-10-17(11-32)29-30-31/h4-7,10-11,14H,2-3,8-9,25-26H2,1H3,(H,28,33)/b15-4-,18-5+ |
| InChIKey | INPXLWGEQZJAQF-RENOARRESA-N |
| XLogP | 1.93 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|