C17H24N6O2 — CID 144992948
methyl 1-[(Z)-5-amino-6-(2-amino-5-cyclopropyl-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate (PubChem CID 144992948) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl 1-[(Z)-5-amino-6-(2-amino-5-cyclopropyl-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(Z)-5-amino-6-(2-amino-5-cyclopropyl-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 144992948 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl 1-[(Z)-5-amino-6-(2-amino-5-cyclopropyl-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CCCC/C(N)=C/c2cc(C3CC3)[nH]c2N)nn1 |
| InChI | InChI=1S/C17H24N6O2/c1-25-17(24)15-10-23(22-21-15)7-3-2-4-13(18)8-12-9-14(11-5-6-11)20-16(12)19/h8-11,20H,2-7,18-19H2,1H3/b13-8- |
| InChIKey | OKYGVPXKCNNPDZ-JYRVWZFOSA-N |
| XLogP | 2.02 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|