C14H20N6O2 — CID 144993098
methyl 1-[(Z)-5-amino-6-(2-amino-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate (PubChem CID 144993098) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl 1-[(Z)-5-amino-6-(2-amino-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(Z)-5-amino-6-(2-amino-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 144993098 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | methyl 1-[(Z)-5-amino-6-(2-amino-1H-pyrrol-3-yl)hex-5-enyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CCCC/C(N)=C/c2cc[nH]c2N)nn1 |
| InChI | InChI=1S/C14H20N6O2/c1-22-14(21)12-9-20(19-18-12)7-3-2-4-11(15)8-10-5-6-17-13(10)16/h5-6,8-9,17H,2-4,7,15-16H2,1H3/b11-8- |
| InChIKey | BBEMTHGZESJDOO-FLIBITNWSA-N |
| XLogP | 1.15 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|