C15H18N6O2 — CID 144992954
methyl 1-[4-(5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxylate (PubChem CID 144992954) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is methyl 1-[4-(5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[4-(5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 144992954 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | methyl 1-[4-(5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CCCCc2cc3c(C)c[nH]c3nn2)nn1 |
| InChI | InChI=1S/C15H18N6O2/c1-10-8-16-14-12(10)7-11(17-19-14)5-3-4-6-21-9-13(18-20-21)15(22)23-2/h7-9H,3-6H2,1-2H3,(H,16,19) |
| InChIKey | ODDKCWQBFSDAIJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|