C12H15BrN6O2 — CID 118620703
methyl 1-[4-(6-amino-5-bromopyridazin-3-yl)butyl]triazole-4-carboxylate (PubChem CID 118620703) has the molecular formula C12H15BrN6O2 and a molecular weight of 355.20 g/mol. Its IUPAC name is methyl 1-[4-(6-amino-5-bromopyridazin-3-yl)butyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[4-(6-amino-5-bromopyridazin-3-yl)butyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 118620703 |
| Molecular Formula | C12H15BrN6O2 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | methyl 1-[4-(6-amino-5-bromopyridazin-3-yl)butyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CCCCc2cc(Br)c(N)nn2)nn1 |
| InChI | InChI=1S/C12H15BrN6O2/c1-21-12(20)10-7-19(18-16-10)5-3-2-4-8-6-9(13)11(14)17-15-8/h6-7H,2-5H2,1H3,(H2,14,17) |
| InChIKey | QOULKSALERVBPN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|