C28H29ClN8O — CID 144992973
[1-[4-[5-(3-chlorophenyl)-6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]triazol-4-yl]-(pyridin-2-ylmethylamino)methanol (PubChem CID 144992973) has the molecular formula C28H29ClN8O and a molecular weight of 529.05 g/mol. Its IUPAC name is [1-[4-[5-(3-chlorophenyl)-6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]triazol-4-yl]-(pyridin-2-ylmethylamino)methanol.
| Compound Name | [1-[4-[5-(3-chlorophenyl)-6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]triazol-4-yl]-(pyridin-2-ylmethylamino)methanol |
|---|---|
| PubChem CID | 144992973 |
| Molecular Formula | C28H29ClN8O |
| Molecular Weight | 529.05 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | [1-[4-[5-(3-chlorophenyl)-6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]triazol-4-yl]-(pyridin-2-ylmethylamino)methanol |
| SMILES | OC(NCc1ccccn1)c1cn(CCCCc2cc3c(-c4cccc(Cl)c4)c(C4CC4)[nH]c3nn2)nn1 |
| InChI | InChI=1S/C28H29ClN8O/c29-20-7-5-6-19(14-20)25-23-15-21(33-35-27(23)32-26(25)18-10-11-18)8-2-4-13-37-17-24(34-36-37)28(38)31-16-22-9-1-3-12-30-22/h1,3,5-7,9,12,14-15,17-18,28,31,38H,2,4,8,10-11,13,16H2,(H,32,35) |
| InChIKey | GDYBPPLPXJJYSW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|