C24H28ClF3N2O5 — CID 144994063
2-chloro-N-[[4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]oxolan-2-yl]methyl]benzamide;propane-2,2-diol (PubChem CID 144994063) has the molecular formula C24H28ClF3N2O5 and a molecular weight of 516.94 g/mol. Its IUPAC name is 2-chloro-N-[[4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]oxolan-2-yl]methyl]benzamide;propane-2,2-diol.
| Compound Name | 2-chloro-N-[[4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]oxolan-2-yl]methyl]benzamide;propane-2,2-diol |
|---|---|
| PubChem CID | 144994063 |
| Molecular Formula | C24H28ClF3N2O5 |
| Molecular Weight | 516.94 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-chloro-N-[[4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]oxolan-2-yl]methyl]benzamide;propane-2,2-diol |
| SMILES | CC(C)(O)O.O=C(NCC1COC(CNC(=O)c2ccccc2Cl)C1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20ClF3N2O3.C3H8O2/c22-18-4-2-1-3-17(18)20(29)27-11-16-9-13(12-30-16)10-26-19(28)14-5-7-15(8-6-14)21(23,24)25;1-3(2,4)5/h1-8,13,16H,9-12H2,(H,26,28)(H,27,29);4-5H,1-2H3 |
| InChIKey | SATRBGQQSULHHI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.94 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|