C19H17ClF2N6O2 — CID 144999641
1-[[4-[4-amino-2-(2,4-difluorophenoxy)pyrimidine-5-carboximidoyl]-5-chloro-2-pyridinyl]amino]propan-2-ol (PubChem CID 144999641) has the molecular formula C19H17ClF2N6O2 and a molecular weight of 434.83 g/mol. Its IUPAC name is 1-[[4-[4-amino-2-(2,4-difluorophenoxy)pyrimidine-5-carboximidoyl]-5-chloro-2-pyridinyl]amino]propan-2-ol.
| Compound Name | 1-[[4-[4-amino-2-(2,4-difluorophenoxy)pyrimidine-5-carboximidoyl]-5-chloro-2-pyridinyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 144999641 |
| Molecular Formula | C19H17ClF2N6O2 |
| Molecular Weight | 434.83 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-[[4-[4-amino-2-(2,4-difluorophenoxy)pyrimidine-5-carboximidoyl]-5-chloro-2-pyridinyl]amino]propan-2-ol |
| SMILES | [H]/N=C(\c1cc(NCC(C)O)ncc1Cl)c1cnc(Oc2ccc(F)cc2F)nc1N |
| InChI | InChI=1S/C19H17ClF2N6O2/c1-9(29)6-25-16-5-11(13(20)8-26-16)17(23)12-7-27-19(28-18(12)24)30-15-3-2-10(21)4-14(15)22/h2-5,7-9,23,29H,6H2,1H3,(H,25,26)(H2,24,27,28)/b23-17+ |
| InChIKey | ZJPURTMWHXBTBF-HAVVHWLPSA-N |
| XLogP | 3.39 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|