C16H17NO2 — CID 14500432
2-(2,3-dihydro-1H-inden-4-yloxy)-1-pyridin-2-ylethanol (PubChem CID 14500432) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-4-yloxy)-1-pyridin-2-ylethanol.
| Compound Name | 2-(2,3-dihydro-1H-inden-4-yloxy)-1-pyridin-2-ylethanol |
|---|---|
| PubChem CID | 14500432 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-4-yloxy)-1-pyridin-2-ylethanol |
| SMILES | OC(COc1cccc2c1CCC2)c1ccccn1 |
| InChI | InChI=1S/C16H17NO2/c18-15(14-8-1-2-10-17-14)11-19-16-9-4-6-12-5-3-7-13(12)16/h1-2,4,6,8-10,15,18H,3,5,7,11H2 |
| InChIKey | PYYRYYVRQNFTIV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |