C21H27N7O — CID 145004991
4-[[amino-[(Z)-2-amino-2-(3-aminoisoquinolin-4-yl)ethenyl]amino]methyl]-N'-hydroxybenzenecarboximidamide;ethane (PubChem CID 145004991) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 4-[[amino-[(Z)-2-amino-2-(3-aminoisoquinolin-4-yl)ethenyl]amino]methyl]-N'-hydroxybenzenecarboximidamide;ethane.
| Compound Name | 4-[[amino-[(Z)-2-amino-2-(3-aminoisoquinolin-4-yl)ethenyl]amino]methyl]-N'-hydroxybenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 145004991 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 4-[[amino-[(Z)-2-amino-2-(3-aminoisoquinolin-4-yl)ethenyl]amino]methyl]-N'-hydroxybenzenecarboximidamide;ethane |
| SMILES | CC.N/C(=C\N(N)Cc1ccc(/C(N)=N\O)cc1)c1c(N)ncc2ccccc12 |
| InChI | InChI=1S/C19H21N7O.C2H6/c20-16(17-15-4-2-1-3-14(15)9-24-19(17)22)11-26(23)10-12-5-7-13(8-6-12)18(21)25-27;1-2/h1-9,11,27H,10,20,23H2,(H2,21,25)(H2,22,24);1-2H3/b16-11-; |
| InChIKey | DSANZWHWZPVNAR-MWVRIADDSA-N |
| XLogP | 2.57 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|